C9H9NO3 information

The molecular formula C9H9NO3 (molar mass: 179.175 g/mol) may refer to: Acedoben N-Acetylanthranilic acid Adrenochrome Hippuric acid This set index page...

InChI InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3 Y Key: RPHLQSHHTJORHI-UHFFFAOYSA-N Y (racemic): InChI=1/C9H9NO3...

InChI InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12) Y Key: QIAFMBKCNZACKA-UHFFFAOYSA-N Y InChI=1/C9H9NO3...

5-methoxyindole 1006-94-6 6-methoxyindole 3189-13-7 indole-3-carbinol 700-06-1 C9H9NO3 hippuric acid 495-69-2 C9H9NO6 Stizolobic acid 15911-87-2 C9H10O chavicol...

or N-acetyl-PABA) is a chemical compound with the molecular formula of C9H9NO3. It is the acetyl derivative of para-aminobenzoic acid (PABA). Acedoben...

acetamide 621-79-4 C9H9NO cinnamaldehyde oxime 13372-81-1 C9H9NO3 malonanilic acid 15580-32-2 C9H9NO3 salacetamide 487-48-9 C9H9N3O2S2 sulfathiazole 72-14-0...