The molecular formula C6H5NO2 (molar mass: 123.11 g/mol, exact mass: 123.0320 u) may refer to:
Nitrobenzene
Pyridinecarboxylic acid
Isonicotinic acid
Niacin
Picolinic acid
3-Hydroxyisonicotinaldehyde
Index of chemical compounds with the same molecular formula
This set index page lists chemical structure articles associated with the same molecular formula. If an internal link led you here, you may wish to change the link to point directly to the intended article.
The molecular formula C6H5NO2 (molar mass: 123.11 g/mol, exact mass: 123.0320 u) may refer to: Nitrobenzene Pyridinecarboxylic acid Isonicotinic acid...
compound and the simplest of the nitrobenzenes, with the chemical formula C6H5NO2. It is a water-insoluble pale yellow oil with an almond-like odor. It freezes...
DTXSID8020757 InChI InChI=1S/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9) Y Key: TWBYWOBDOCUKOW-UHFFFAOYSA-N Y InChI=1/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H...
isomers share the molecular weight 123,11 g/mol and the chemical formula C6H5NO2. Pyridinedicarboxylic acid This set index article lists chemical compounds...
Some polar liquids, such as nitrotoluene (C7H7NO2) and nitrobenzene (C6H5NO2) exhibit very large Kerr constants. A glass cell filled with one of these...
DTXSID7031903 InChI InChI=1S/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9) Y Key: SIOXPEMLGUPBBT-UHFFFAOYSA-N Y InChI=1/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H...
DTXSID1020932 InChI InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) Y Key: PVNIIMVLHYAWGP-UHFFFAOYSA-N Y InChI=1/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H...
cuprous oxide, which generates cuprous nitrite in situ: [C6H5N2]+ + CuNO2 → C6H5NO2 + N2 + Cu+ The cyano group usually cannot be introduced by nucleophilic...
hexachlorobenzene (HCB), which is considered as hazardous as PCNB. 5 Cl2 + C6H5NO2 → C6Cl5NO2 + 5 HCl Reaction with ethanol and potassium hydroxide yields...
Global Information